C25H23N — CID 19838437
1,1'-biphenyl;3-methyl-N-phenylaniline (PubChem CID 19838437) has the molecular formula C25H23N and a molecular weight of 337.47 g/mol. Its IUPAC name is 1,1'-biphenyl;3-methyl-N-phenylaniline.
| Compound Name | 1,1'-biphenyl;3-methyl-N-phenylaniline |
|---|---|
| PubChem CID | 19838437 |
| Molecular Formula | C25H23N |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1,1'-biphenyl;3-methyl-N-phenylaniline |
| SMILES | Cc1cccc(Nc2ccccc2)c1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H13N.C12H10/c1-11-6-5-9-13(10-11)14-12-7-3-2-4-8-12;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h2-10,14H,1H3;1-10H |
| InChIKey | WTCRSTXCHUSGAA-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |