C17H14Cl2N4O — CID 69311210
2-(2H-benzotriazol-4-yl)-1-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one (PubChem CID 69311210) has the molecular formula C17H14Cl2N4O and a molecular weight of 361.23 g/mol. Its IUPAC name is 2-(2H-benzotriazol-4-yl)-1-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one.
| Compound Name | 2-(2H-benzotriazol-4-yl)-1-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one |
|---|---|
| PubChem CID | 69311210 |
| Molecular Formula | C17H14Cl2N4O |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-(2H-benzotriazol-4-yl)-1-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one |
| SMILES | CN(C)C=C(C(=O)c1ccc(Cl)cc1Cl)c1cccc2n[nH]nc12 |
| InChI | InChI=1S/C17H14Cl2N4O/c1-23(2)9-13(11-4-3-5-15-16(11)21-22-20-15)17(24)12-7-6-10(18)8-14(12)19/h3-9H,1-2H3,(H,20,21,22) |
| InChIKey | FPWIEWXQJTZJBA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|