C24H35N3O — CID 141060807
(9Z,12Z)-1-(2H-benzotriazol-4-yl)octadeca-9,12-dien-1-one (PubChem CID 141060807) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is (9Z,12Z)-1-(2H-benzotriazol-4-yl)octadeca-9,12-dien-1-one.
| Compound Name | (9Z,12Z)-1-(2H-benzotriazol-4-yl)octadeca-9,12-dien-1-one |
|---|---|
| PubChem CID | 141060807 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | (9Z,12Z)-1-(2H-benzotriazol-4-yl)octadeca-9,12-dien-1-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)c1cccc2n[nH]nc12 |
| InChI | InChI=1S/C24H35N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23(28)21-18-17-19-22-24(21)26-27-25-22/h6-7,9-10,17-19H,2-5,8,11-16,20H2,1H3,(H,25,26,27)/b7-6-,10-9- |
| InChIKey | HCHDRQOGHPJOQQ-HZJYTTRNSA-N |
| XLogP | 6.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|