C23H41N3O2P+ — CID 175789325
2H-benzotriazole-4-carboxylic acid;tetrabutylphosphanium (PubChem CID 175789325) has the molecular formula C23H41N3O2P+ and a molecular weight of 422.57 g/mol. Its IUPAC name is 2H-benzotriazole-4-carboxylic acid;tetrabutylphosphanium.
| Compound Name | 2H-benzotriazole-4-carboxylic acid;tetrabutylphosphanium |
|---|---|
| PubChem CID | 175789325 |
| Molecular Formula | C23H41N3O2P+ |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 2H-benzotriazole-4-carboxylic acid;tetrabutylphosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.O=C(O)c1cccc2n[nH]nc12 |
| InChI | InChI=1S/C16H36P.C7H5N3O2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;11-7(12)4-2-1-3-5-6(4)9-10-8-5/h5-16H2,1-4H3;1-3H,(H,11,12)(H,8,9,10)/q+1; |
| InChIKey | FWMJZFFRCBFBEH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|