C15H9Cl2N3O — CID 135057764
(2,4-dichlorophenyl)-(5-phenyl-2H-triazol-4-yl)methanone (PubChem CID 135057764) has the molecular formula C15H9Cl2N3O and a molecular weight of 318.16 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(5-phenyl-2H-triazol-4-yl)methanone.
| Compound Name | (2,4-dichlorophenyl)-(5-phenyl-2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 135057764 |
| Molecular Formula | C15H9Cl2N3O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | (2,4-dichlorophenyl)-(5-phenyl-2H-triazol-4-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)c1n[nH]nc1-c1ccccc1 |
| InChI | InChI=1S/C15H9Cl2N3O/c16-10-6-7-11(12(17)8-10)15(21)14-13(18-20-19-14)9-4-2-1-3-5-9/h1-8H,(H,18,19,20) |
| InChIKey | UTKVKIHJMHBINO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |