C19H12Cl2N2O2 — CID 52912768
4-[(E)-3-(2,4-dichlorophenyl)-3-oxoprop-1-enyl]-3-phenyl-1H-pyridazin-6-one (PubChem CID 52912768) has the molecular formula C19H12Cl2N2O2 and a molecular weight of 371.22 g/mol. Its IUPAC name is 4-[(E)-3-(2,4-dichlorophenyl)-3-oxoprop-1-enyl]-3-phenyl-1H-pyridazin-6-one.
| Compound Name | 4-[(E)-3-(2,4-dichlorophenyl)-3-oxoprop-1-enyl]-3-phenyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 52912768 |
| Molecular Formula | C19H12Cl2N2O2 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 4-[(E)-3-(2,4-dichlorophenyl)-3-oxoprop-1-enyl]-3-phenyl-1H-pyridazin-6-one |
| SMILES | O=C(/C=C/c1cc(=O)[nH]nc1-c1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H12Cl2N2O2/c20-14-7-8-15(16(21)11-14)17(24)9-6-13-10-18(25)22-23-19(13)12-4-2-1-3-5-12/h1-11H,(H,22,25)/b9-6+ |
| InChIKey | UBMIZUVTYHYEPH-RMKNXTFCSA-N |
| XLogP | 4.64 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|