C15H5Cl2F5O — CID 3396457
1-(2,4-dichlorophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one (PubChem CID 3396457) has the molecular formula C15H5Cl2F5O and a molecular weight of 367.10 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3396457 |
| Molecular Formula | C15H5Cl2F5O |
| Molecular Weight | 367.10 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1c(F)c(F)c(F)c(F)c1F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H5Cl2F5O/c16-6-1-2-7(9(17)5-6)10(23)4-3-8-11(18)13(20)15(22)14(21)12(8)19/h1-5H |
| InChIKey | GPVMZEINOHAPHV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.10 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|