C27H20N4O2 — CID 155934303
(2-hydroxyphenyl)-[5-[4-(N-phenylanilino)phenyl]-2H-triazol-4-yl]methanone (PubChem CID 155934303) has the molecular formula C27H20N4O2 and a molecular weight of 432.48 g/mol. Its IUPAC name is (2-hydroxyphenyl)-[5-[4-(N-phenylanilino)phenyl]-2H-triazol-4-yl]methanone.
| Compound Name | (2-hydroxyphenyl)-[5-[4-(N-phenylanilino)phenyl]-2H-triazol-4-yl]methanone |
|---|---|
| PubChem CID | 155934303 |
| Molecular Formula | C27H20N4O2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (2-hydroxyphenyl)-[5-[4-(N-phenylanilino)phenyl]-2H-triazol-4-yl]methanone |
| SMILES | O=C(c1ccccc1O)c1n[nH]nc1-c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H20N4O2/c32-24-14-8-7-13-23(24)27(33)26-25(28-30-29-26)19-15-17-22(18-16-19)31(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-18,32H,(H,28,29,30) |
| InChIKey | CIODWKUZJUWPSH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |