About 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid
5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid (PubChem CID 155250572) has the molecular formula C15H9Cl2N3O2
and a molecular weight of 334.16 g/mol. Its IUPAC name is 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid |
| PubChem CID | 155250572 |
| Molecular Formula | C15H9Cl2N3O2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid |
| SMILES | O=C(O)c1n[nH]nc1-c1cccc(-c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C15H9Cl2N3O2/c16-11-5-4-9(7-12(11)17)8-2-1-3-10(6-8)13-14(15(21)22)19-20-18-13/h1-7H,(H,21,22)(H,18,19,20) |
| InChIKey | DIBWRICGKCZEJP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid?
The IUPAC name of 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid (CID 155250572) is 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid.
What is the SMILES notation for 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid?
The canonical SMILES for 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid is O=C(O)c1n[nH]nc1-c1cccc(-c2ccc(Cl)c(Cl)c2)c1.
What is the InChIKey of 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid?
The InChIKey is DIBWRICGKCZEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Cl2N3O2/c16-11-5-4-9(7-12(11)17)8-2-1-3-10(6-8)13-14(15(21)22)19-20-18-13/h1-7H,(H,21,22)(H,18,19,20).
What are the key properties of 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid?
5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid has a molecular weight of 334.16 g/mol, XLogP of 4.14, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(3,4-dichlorophenyl)phenyl]-2H-triazole-4-carboxylic acid is sourced from PubChem (CID 155250572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).