C16H12ClN3O2 — CID 100663799
(4-chlorophenyl)methyl 5-phenyl-2H-triazole-4-carboxylate (PubChem CID 100663799) has the molecular formula C16H12ClN3O2 and a molecular weight of 313.74 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 5-phenyl-2H-triazole-4-carboxylate.
| Compound Name | (4-chlorophenyl)methyl 5-phenyl-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 100663799 |
| Molecular Formula | C16H12ClN3O2 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (4-chlorophenyl)methyl 5-phenyl-2H-triazole-4-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)cc1)c1n[nH]nc1-c1ccccc1 |
| InChI | InChI=1S/C16H12ClN3O2/c17-13-8-6-11(7-9-13)10-22-16(21)15-14(18-20-19-15)12-4-2-1-3-5-12/h1-9H,10H2,(H,18,19,20) |
| InChIKey | KBZFOKAUIUUYOK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |