C14H14Cl2N6O2 — CID 132968742
1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 132968742) has the molecular formula C14H14Cl2N6O2 and a molecular weight of 369.21 g/mol. Its IUPAC name is 1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | 1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 132968742 |
| Molecular Formula | C14H14Cl2N6O2 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnnn1)N1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H14Cl2N6O2/c15-10-1-2-11(12(16)7-10)14(24)21-5-3-20(4-6-21)13(23)8-22-9-17-18-19-22/h1-2,7,9H,3-6,8H2 |
| InChIKey | LXNMSULMXCVTKQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |