C19H23ClN6O2 — CID 78905225
1-[4-[1-(4-chlorophenyl)cyclopentanecarbonyl]piperazin-1-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 78905225) has the molecular formula C19H23ClN6O2 and a molecular weight of 402.89 g/mol. Its IUPAC name is 1-[4-[1-(4-chlorophenyl)cyclopentanecarbonyl]piperazin-1-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | 1-[4-[1-(4-chlorophenyl)cyclopentanecarbonyl]piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 78905225 |
| Molecular Formula | C19H23ClN6O2 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1-[4-[1-(4-chlorophenyl)cyclopentanecarbonyl]piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnnn1)N1CCN(C(=O)C2(c3ccc(Cl)cc3)CCCC2)CC1 |
| InChI | InChI=1S/C19H23ClN6O2/c20-16-5-3-15(4-6-16)19(7-1-2-8-19)18(28)25-11-9-24(10-12-25)17(27)13-26-14-21-22-23-26/h3-6,14H,1-2,7-13H2 |
| InChIKey | KOAKAWSJBKLWOL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |