C15H18N6O3 — CID 131960673
1-[4-(2-hydroxy-5-methylbenzoyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 131960673) has the molecular formula C15H18N6O3 and a molecular weight of 330.35 g/mol. Its IUPAC name is 1-[4-(2-hydroxy-5-methylbenzoyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | 1-[4-(2-hydroxy-5-methylbenzoyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 131960673 |
| Molecular Formula | C15H18N6O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[4-(2-hydroxy-5-methylbenzoyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | Cc1ccc(O)c(C(=O)N2CCN(C(=O)Cn3cnnn3)CC2)c1 |
| InChI | InChI=1S/C15H18N6O3/c1-11-2-3-13(22)12(8-11)15(24)20-6-4-19(5-7-20)14(23)9-21-10-16-17-18-21/h2-3,8,10,22H,4-7,9H2,1H3 |
| InChIKey | VXXZPWGTSFPZKX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |