C23H29N7O2 — CID 78905394
1-[4-[2,5-dimethyl-1-(3-propan-2-ylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 78905394) has the molecular formula C23H29N7O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 1-[4-[2,5-dimethyl-1-(3-propan-2-ylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | 1-[4-[2,5-dimethyl-1-(3-propan-2-ylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 78905394 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 1-[4-[2,5-dimethyl-1-(3-propan-2-ylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)Cn3cnnn3)CC2)c(C)n1-c1cccc(C(C)C)c1 |
| InChI | InChI=1S/C23H29N7O2/c1-16(2)19-6-5-7-20(13-19)30-17(3)12-21(18(30)4)23(32)28-10-8-27(9-11-28)22(31)14-29-15-24-25-26-29/h5-7,12-13,15-16H,8-11,14H2,1-4H3 |
| InChIKey | OWFRFKZFECKPMX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|