C21H27N3O — CID 56523461
N-(1-cyanopropan-2-yl)-N,2,5-trimethyl-1-(3-propan-2-ylphenyl)pyrrole-3-carboxamide (PubChem CID 56523461) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is N-(1-cyanopropan-2-yl)-N,2,5-trimethyl-1-(3-propan-2-ylphenyl)pyrrole-3-carboxamide.
| Compound Name | N-(1-cyanopropan-2-yl)-N,2,5-trimethyl-1-(3-propan-2-ylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 56523461 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-(1-cyanopropan-2-yl)-N,2,5-trimethyl-1-(3-propan-2-ylphenyl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C(C)CC#N)c(C)n1-c1cccc(C(C)C)c1 |
| InChI | InChI=1S/C21H27N3O/c1-14(2)18-8-7-9-19(13-18)24-16(4)12-20(17(24)5)21(25)23(6)15(3)10-11-22/h7-9,12-15H,10H2,1-6H3 |
| InChIKey | VEMPMCPOOFJDLA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|