C22H25N3O — CID 77084067
N,2,5-trimethyl-1-phenyl-N-(1-pyridin-3-ylpropyl)pyrrole-3-carboxamide (PubChem CID 77084067) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is N,2,5-trimethyl-1-phenyl-N-(1-pyridin-3-ylpropyl)pyrrole-3-carboxamide.
| Compound Name | N,2,5-trimethyl-1-phenyl-N-(1-pyridin-3-ylpropyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 77084067 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N,2,5-trimethyl-1-phenyl-N-(1-pyridin-3-ylpropyl)pyrrole-3-carboxamide |
| SMILES | CCC(c1cccnc1)N(C)C(=O)c1cc(C)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C22H25N3O/c1-5-21(18-10-9-13-23-15-18)24(4)22(26)20-14-16(2)25(17(20)3)19-11-7-6-8-12-19/h6-15,21H,5H2,1-4H3 |
| InChIKey | VQEZZFSUPYLTAR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|