C21H25N3O — CID 97113366
N,3,5,7-tetramethyl-N-[(1S)-1-pyridin-3-ylpropyl]-1H-indole-2-carboxamide (PubChem CID 97113366) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is N,3,5,7-tetramethyl-N-[(1S)-1-pyridin-3-ylpropyl]-1H-indole-2-carboxamide.
| Compound Name | N,3,5,7-tetramethyl-N-[(1S)-1-pyridin-3-ylpropyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 97113366 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N,3,5,7-tetramethyl-N-[(1S)-1-pyridin-3-ylpropyl]-1H-indole-2-carboxamide |
| SMILES | CC[C@@H](c1cccnc1)N(C)C(=O)c1[nH]c2c(C)cc(C)cc2c1C |
| InChI | InChI=1S/C21H25N3O/c1-6-18(16-8-7-9-22-12-16)24(5)21(25)20-15(4)17-11-13(2)10-14(3)19(17)23-20/h7-12,18,23H,6H2,1-5H3/t18-/m0/s1 |
| InChIKey | QZILXEACQZFXAB-SFHVURJKSA-N |
| XLogP | 4.71 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|