C19H29N5O — CID 118763854
1-methyl-3-(4-methyl-1-pentan-3-ylpyrazol-5-yl)-1-(1-pyridin-3-ylpropyl)urea (PubChem CID 118763854) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is 1-methyl-3-(4-methyl-1-pentan-3-ylpyrazol-5-yl)-1-(1-pyridin-3-ylpropyl)urea.
| Compound Name | 1-methyl-3-(4-methyl-1-pentan-3-ylpyrazol-5-yl)-1-(1-pyridin-3-ylpropyl)urea |
|---|---|
| PubChem CID | 118763854 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 1-methyl-3-(4-methyl-1-pentan-3-ylpyrazol-5-yl)-1-(1-pyridin-3-ylpropyl)urea |
| SMILES | CCC(c1cccnc1)N(C)C(=O)Nc1c(C)cnn1C(CC)CC |
| InChI | InChI=1S/C19H29N5O/c1-6-16(7-2)24-18(14(4)12-21-24)22-19(25)23(5)17(8-3)15-10-9-11-20-13-15/h9-13,16-17H,6-8H2,1-5H3,(H,22,25) |
| InChIKey | DJKLTEHCQBBBHM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |