C21H28N4O2 — CID 125172275
N,3-dimethyl-4-[[methyl-[(1S)-1-pyridin-3-ylpentyl]carbamoyl]amino]benzamide (PubChem CID 125172275) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N,3-dimethyl-4-[[methyl-[(1S)-1-pyridin-3-ylpentyl]carbamoyl]amino]benzamide.
| Compound Name | N,3-dimethyl-4-[[methyl-[(1S)-1-pyridin-3-ylpentyl]carbamoyl]amino]benzamide |
|---|---|
| PubChem CID | 125172275 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N,3-dimethyl-4-[[methyl-[(1S)-1-pyridin-3-ylpentyl]carbamoyl]amino]benzamide |
| SMILES | CCCC[C@@H](c1cccnc1)N(C)C(=O)Nc1ccc(C(=O)NC)cc1C |
| InChI | InChI=1S/C21H28N4O2/c1-5-6-9-19(17-8-7-12-23-14-17)25(4)21(27)24-18-11-10-16(13-15(18)2)20(26)22-3/h7-8,10-14,19H,5-6,9H2,1-4H3,(H,22,26)(H,24,27)/t19-/m0/s1 |
| InChIKey | QLKWLRSSHOBORE-IBGZPJMESA-N |
| XLogP | 4.14 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |