C19H23F2N3O — CID 119065675
3-[(2,5-difluorophenyl)methyl]-1-methyl-1-(1-pyridin-3-ylpentyl)urea (PubChem CID 119065675) has the molecular formula C19H23F2N3O and a molecular weight of 347.41 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methyl]-1-methyl-1-(1-pyridin-3-ylpentyl)urea.
| Compound Name | 3-[(2,5-difluorophenyl)methyl]-1-methyl-1-(1-pyridin-3-ylpentyl)urea |
|---|---|
| PubChem CID | 119065675 |
| Molecular Formula | C19H23F2N3O |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methyl]-1-methyl-1-(1-pyridin-3-ylpentyl)urea |
| SMILES | CCCCC(c1cccnc1)N(C)C(=O)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C19H23F2N3O/c1-3-4-7-18(14-6-5-10-22-12-14)24(2)19(25)23-13-15-11-16(20)8-9-17(15)21/h5-6,8-12,18H,3-4,7,13H2,1-2H3,(H,23,25) |
| InChIKey | HHSAJEFMSHMVMF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |