About 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide
6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide (PubChem CID 97113120) has the molecular formula C22H26N2O3
and a molecular weight of 366.46 g/mol. Its IUPAC name is 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide |
| PubChem CID | 97113120 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide |
| SMILES | CCCC[C@H](c1cccnc1)N(C)C(=O)c1oc2cc(OC)ccc2c1C |
| InChI | InChI=1S/C22H26N2O3/c1-5-6-9-19(16-8-7-12-23-14-16)24(3)22(25)21-15(2)18-11-10-17(26-4)13-20(18)27-21/h7-8,10-14,19H,5-6,9H2,1-4H3/t19-/m1/s1 |
| InChIKey | CWKUNDWKCGFUOW-LJQANCHMSA-N |
| XLogP | 5.15 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide?
The IUPAC name of 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide (CID 97113120) is 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide.
What is the SMILES notation for 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide?
The canonical SMILES for 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide is CCCC[C@H](c1cccnc1)N(C)C(=O)c1oc2cc(OC)ccc2c1C.
What is the InChIKey of 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide?
The InChIKey is CWKUNDWKCGFUOW-LJQANCHMSA-N. The full InChI is InChI=1S/C22H26N2O3/c1-5-6-9-19(16-8-7-12-23-14-16)24(3)22(25)21-15(2)18-11-10-17(26-4)13-20(18)27-21/h7-8,10-14,19H,5-6,9H2,1-4H3/t19-/m1/s1.
What are the key properties of 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide?
6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide has a molecular weight of 366.46 g/mol, XLogP of 5.15, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-N,3-dimethyl-N-[(1R)-1-pyridin-3-ylpentyl]-1-benzofuran-2-carboxamide is sourced from PubChem (CID 97113120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).