C24H27N3O2S — CID 131908751
N-methyl-N-[2-[methyl(1-pyridin-3-ylpentyl)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 131908751) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is N-methyl-N-[2-[methyl(1-pyridin-3-ylpentyl)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-methyl-N-[2-[methyl(1-pyridin-3-ylpentyl)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 131908751 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-methyl-N-[2-[methyl(1-pyridin-3-ylpentyl)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CCCCC(c1cccnc1)N(C)C(=O)c1ccccc1N(C)C(=O)c1cccs1 |
| InChI | InChI=1S/C24H27N3O2S/c1-4-5-12-20(18-10-8-15-25-17-18)26(2)23(28)19-11-6-7-13-21(19)27(3)24(29)22-14-9-16-30-22/h6-11,13-17,20H,4-5,12H2,1-3H3 |
| InChIKey | PYRKFYIYJLYFGK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |