C17H23N5O2 — CID 137027898
1-methyl-3-[(6-oxo-1H-pyrimidin-4-yl)methyl]-1-[(1S)-1-pyridin-3-ylpentyl]urea (PubChem CID 137027898) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-methyl-3-[(6-oxo-1H-pyrimidin-4-yl)methyl]-1-[(1S)-1-pyridin-3-ylpentyl]urea.
| Compound Name | 1-methyl-3-[(6-oxo-1H-pyrimidin-4-yl)methyl]-1-[(1S)-1-pyridin-3-ylpentyl]urea |
|---|---|
| PubChem CID | 137027898 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-methyl-3-[(6-oxo-1H-pyrimidin-4-yl)methyl]-1-[(1S)-1-pyridin-3-ylpentyl]urea |
| SMILES | CCCC[C@@H](c1cccnc1)N(C)C(=O)NCc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C17H23N5O2/c1-3-4-7-15(13-6-5-8-18-10-13)22(2)17(24)19-11-14-9-16(23)21-12-20-14/h5-6,8-10,12,15H,3-4,7,11H2,1-2H3,(H,19,24)(H,20,21,23)/t15-/m0/s1 |
| InChIKey | SIWIPFWTVNGLBS-HNNXBMFYSA-N |
| XLogP | 2.24 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |