C13H18N2O2 — CID 61216786
4-(butanoylamino)-N,3-dimethylbenzamide (PubChem CID 61216786) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-(butanoylamino)-N,3-dimethylbenzamide.
| Compound Name | 4-(butanoylamino)-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 61216786 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-(butanoylamino)-N,3-dimethylbenzamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)NC)cc1C |
| InChI | InChI=1S/C13H18N2O2/c1-4-5-12(16)15-11-7-6-10(8-9(11)2)13(17)14-3/h6-8H,4-5H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | SRQBGUGHIKHHOA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |