C13H20ClN3O2 — CID 119714183
N-ethyl-3-methyl-4-[[2-(methylamino)acetyl]amino]benzamide;hydrochloride (PubChem CID 119714183) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.78 g/mol. Its IUPAC name is N-ethyl-3-methyl-4-[[2-(methylamino)acetyl]amino]benzamide;hydrochloride.
| Compound Name | N-ethyl-3-methyl-4-[[2-(methylamino)acetyl]amino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119714183 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-ethyl-3-methyl-4-[[2-(methylamino)acetyl]amino]benzamide;hydrochloride |
| SMILES | CCNC(=O)c1ccc(NC(=O)CNC)c(C)c1.Cl |
| InChI | InChI=1S/C13H19N3O2.ClH/c1-4-15-13(18)10-5-6-11(9(2)7-10)16-12(17)8-14-3;/h5-7,14H,4,8H2,1-3H3,(H,15,18)(H,16,17);1H |
| InChIKey | LEFBSCVMBPLHHC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |