C20H25N3O3 — CID 50963279
N-(2-ethoxyphenyl)-N'-methyl-N'-(1-pyridin-3-ylpropyl)propanediamide (PubChem CID 50963279) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-N'-methyl-N'-(1-pyridin-3-ylpropyl)propanediamide.
| Compound Name | N-(2-ethoxyphenyl)-N'-methyl-N'-(1-pyridin-3-ylpropyl)propanediamide |
|---|---|
| PubChem CID | 50963279 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-(2-ethoxyphenyl)-N'-methyl-N'-(1-pyridin-3-ylpropyl)propanediamide |
| SMILES | CCOc1ccccc1NC(=O)CC(=O)N(C)C(CC)c1cccnc1 |
| InChI | InChI=1S/C20H25N3O3/c1-4-17(15-9-8-12-21-14-15)23(3)20(25)13-19(24)22-16-10-6-7-11-18(16)26-5-2/h6-12,14,17H,4-5,13H2,1-3H3,(H,22,24) |
| InChIKey | GXDUECFRGGPGCT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|