C16H20N4O3 — CID 50956495
N-(2-ethoxyphenyl)-N'-methyl-N'-(1H-pyrazol-5-ylmethyl)propanediamide (PubChem CID 50956495) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-N'-methyl-N'-(1H-pyrazol-5-ylmethyl)propanediamide.
| Compound Name | N-(2-ethoxyphenyl)-N'-methyl-N'-(1H-pyrazol-5-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 50956495 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-(2-ethoxyphenyl)-N'-methyl-N'-(1H-pyrazol-5-ylmethyl)propanediamide |
| SMILES | CCOc1ccccc1NC(=O)CC(=O)N(C)Cc1ccn[nH]1 |
| InChI | InChI=1S/C16H20N4O3/c1-3-23-14-7-5-4-6-13(14)18-15(21)10-16(22)20(2)11-12-8-9-17-19-12/h4-9H,3,10-11H2,1-2H3,(H,17,19)(H,18,21) |
| InChIKey | SQFYNQLRWIJBCT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|