About N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide
N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide (PubChem CID 50964947) has the molecular formula C22H23N3O3
and a molecular weight of 377.44 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide.
Molecular Properties
| Compound Name | N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide |
| PubChem CID | 50964947 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide |
| SMILES | CCOc1ccccc1NC(=O)CC(=O)N(C)Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C22H23N3O3/c1-3-28-20-11-7-6-10-19(20)24-21(26)14-22(27)25(2)15-16-12-13-23-18-9-5-4-8-17(16)18/h4-13H,3,14-15H2,1-2H3,(H,24,26) |
| InChIKey | UNFVYSJUMCBIIV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide?
The IUPAC name of N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide (CID 50964947) is N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide.
What is the SMILES notation for N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide?
The canonical SMILES for N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide is CCOc1ccccc1NC(=O)CC(=O)N(C)Cc1ccnc2ccccc12.
What is the InChIKey of N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide?
The InChIKey is UNFVYSJUMCBIIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O3/c1-3-28-20-11-7-6-10-19(20)24-21(26)14-22(27)25(2)15-16-12-13-23-18-9-5-4-8-17(16)18/h4-13H,3,14-15H2,1-2H3,(H,24,26).
What are the key properties of N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide?
N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide has a molecular weight of 377.44 g/mol, XLogP of 3.62, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethoxyphenyl)-N'-methyl-N'-(quinolin-4-ylmethyl)propanediamide is sourced from PubChem (CID 50964947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).