C21H25N3O2 — CID 95225196
N-[(2R)-1-hydroxybutan-2-yl]-3,5-dimethyl-N-(pyridin-3-ylmethyl)-1H-indole-2-carboxamide (PubChem CID 95225196) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[(2R)-1-hydroxybutan-2-yl]-3,5-dimethyl-N-(pyridin-3-ylmethyl)-1H-indole-2-carboxamide.
| Compound Name | N-[(2R)-1-hydroxybutan-2-yl]-3,5-dimethyl-N-(pyridin-3-ylmethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 95225196 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-[(2R)-1-hydroxybutan-2-yl]-3,5-dimethyl-N-(pyridin-3-ylmethyl)-1H-indole-2-carboxamide |
| SMILES | CC[C@H](CO)N(Cc1cccnc1)C(=O)c1[nH]c2ccc(C)cc2c1C |
| InChI | InChI=1S/C21H25N3O2/c1-4-17(13-25)24(12-16-6-5-9-22-11-16)21(26)20-15(3)18-10-14(2)7-8-19(18)23-20/h5-11,17,23,25H,4,12-13H2,1-3H3/t17-/m1/s1 |
| InChIKey | DXZVOZIGJMXGSD-QGZVFWFLSA-N |
| XLogP | 3.59 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|