C21H22N2O — CID 30281388
N-benzyl-N,2,5-trimethyl-1-phenylpyrrole-3-carboxamide (PubChem CID 30281388) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is N-benzyl-N,2,5-trimethyl-1-phenylpyrrole-3-carboxamide.
| Compound Name | N-benzyl-N,2,5-trimethyl-1-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 30281388 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-benzyl-N,2,5-trimethyl-1-phenylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)Cc2ccccc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C21H22N2O/c1-16-14-20(17(2)23(16)19-12-8-5-9-13-19)21(24)22(3)15-18-10-6-4-7-11-18/h4-14H,15H2,1-3H3 |
| InChIKey | BJCLDESTRUCHHD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|