C19H21FN4O — CID 31843746
1-(4-fluorophenyl)-N,2,5-trimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrrole-3-carboxamide (PubChem CID 31843746) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N,2,5-trimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrrole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N,2,5-trimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 31843746 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-(4-fluorophenyl)-N,2,5-trimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)Cc2cnn(C)c2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN4O/c1-13-9-18(14(2)24(13)17-7-5-16(20)6-8-17)19(25)22(3)11-15-10-21-23(4)12-15/h5-10,12H,11H2,1-4H3 |
| InChIKey | CXZOZBWZXPEULC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|