C23H27N3O3S — CID 60509128
2,5-dimethyl-1-(3-propan-2-ylphenyl)-N-[(3-sulfamoylphenyl)methyl]pyrrole-3-carboxamide (PubChem CID 60509128) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2,5-dimethyl-1-(3-propan-2-ylphenyl)-N-[(3-sulfamoylphenyl)methyl]pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-1-(3-propan-2-ylphenyl)-N-[(3-sulfamoylphenyl)methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 60509128 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2,5-dimethyl-1-(3-propan-2-ylphenyl)-N-[(3-sulfamoylphenyl)methyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2cccc(S(N)(=O)=O)c2)c(C)n1-c1cccc(C(C)C)c1 |
| InChI | InChI=1S/C23H27N3O3S/c1-15(2)19-8-6-9-20(13-19)26-16(3)11-22(17(26)4)23(27)25-14-18-7-5-10-21(12-18)30(24,28)29/h5-13,15H,14H2,1-4H3,(H,25,27)(H2,24,28,29) |
| InChIKey | WYGYFANTFFZSAD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|