C26H30N4O3 — CID 55814653
N-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrole-3-carboxamide (PubChem CID 55814653) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrole-3-carboxamide.
| Compound Name | N-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55814653 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | N-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ccc(C(=O)NCC(N)=O)cc2)c(C)n1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C26H30N4O3/c1-16(2)20-9-11-22(12-10-20)30-17(3)13-23(18(30)4)26(33)28-14-19-5-7-21(8-6-19)25(32)29-15-24(27)31/h5-13,16H,14-15H2,1-4H3,(H2,27,31)(H,28,33)(H,29,32) |
| InChIKey | SHYPMMYROLYSIQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|