C12H9Cl2N3O2 — CID 139894512
[1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethenyl] acetate (PubChem CID 139894512) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethenyl] acetate.
| Compound Name | [1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethenyl] acetate |
|---|---|
| PubChem CID | 139894512 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethenyl] acetate |
| SMILES | CC(=O)OC(=Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl2N3O2/c1-8(18)19-12(5-17-7-15-6-16-17)10-3-2-9(13)4-11(10)14/h2-7H,1H3 |
| InChIKey | RFDSDBVFCNZEKT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|