C11H10Cl2N4O — CID 57015366
1-(2,4-dichlorophenyl)-N-methoxy-2-(1,2,4-triazol-1-yl)ethenamine (PubChem CID 57015366) has the molecular formula C11H10Cl2N4O and a molecular weight of 285.13 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-methoxy-2-(1,2,4-triazol-1-yl)ethenamine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-methoxy-2-(1,2,4-triazol-1-yl)ethenamine |
|---|---|
| PubChem CID | 57015366 |
| Molecular Formula | C11H10Cl2N4O |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-methoxy-2-(1,2,4-triazol-1-yl)ethenamine |
| SMILES | CONC(=Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N4O/c1-18-16-11(5-17-7-14-6-15-17)9-3-2-8(12)4-10(9)13/h2-7,16H,1H3 |
| InChIKey | YBKDIYUIIDNHIJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|