C20H21ClN4O — CID 57057089
1-(2-chlorophenyl)-2-(1,2,4-triazol-1-yl)-N-[(2,4,6-trimethylphenyl)methoxy]ethenamine (PubChem CID 57057089) has the molecular formula C20H21ClN4O and a molecular weight of 368.87 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-(1,2,4-triazol-1-yl)-N-[(2,4,6-trimethylphenyl)methoxy]ethenamine.
| Compound Name | 1-(2-chlorophenyl)-2-(1,2,4-triazol-1-yl)-N-[(2,4,6-trimethylphenyl)methoxy]ethenamine |
|---|---|
| PubChem CID | 57057089 |
| Molecular Formula | C20H21ClN4O |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-(2-chlorophenyl)-2-(1,2,4-triazol-1-yl)-N-[(2,4,6-trimethylphenyl)methoxy]ethenamine |
| SMILES | Cc1cc(C)c(CONC(=Cn2cncn2)c2ccccc2Cl)c(C)c1 |
| InChI | InChI=1S/C20H21ClN4O/c1-14-8-15(2)18(16(3)9-14)11-26-24-20(10-25-13-22-12-23-25)17-6-4-5-7-19(17)21/h4-10,12-13,24H,11H2,1-3H3 |
| InChIKey | ZFEZYTPZRKXLGT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|