C19H17F2N3O2 — CID 71536259
1-[(E)-2-(2,4-difluorophenyl)-2-[2-(3-methylphenoxy)ethoxy]ethenyl]-1,2,4-triazole (PubChem CID 71536259) has the molecular formula C19H17F2N3O2 and a molecular weight of 357.36 g/mol. Its IUPAC name is 1-[(E)-2-(2,4-difluorophenyl)-2-[2-(3-methylphenoxy)ethoxy]ethenyl]-1,2,4-triazole.
| Compound Name | 1-[(E)-2-(2,4-difluorophenyl)-2-[2-(3-methylphenoxy)ethoxy]ethenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 71536259 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-[(E)-2-(2,4-difluorophenyl)-2-[2-(3-methylphenoxy)ethoxy]ethenyl]-1,2,4-triazole |
| SMILES | Cc1cccc(OCCO/C(=C/n2cncn2)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C19H17F2N3O2/c1-14-3-2-4-16(9-14)25-7-8-26-19(11-24-13-22-12-23-24)17-6-5-15(20)10-18(17)21/h2-6,9-13H,7-8H2,1H3/b19-11+ |
| InChIKey | RSLCMIKVHUSOQP-YBFXNURJSA-N |
| XLogP | 3.92 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|