C19H14Cl3N3O3 — CID 23625915
4-(4-chlorophenoxy)-1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)pentane-1,3-dione (PubChem CID 23625915) has the molecular formula C19H14Cl3N3O3 and a molecular weight of 438.70 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)pentane-1,3-dione.
| Compound Name | 4-(4-chlorophenoxy)-1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)pentane-1,3-dione |
|---|---|
| PubChem CID | 23625915 |
| Molecular Formula | C19H14Cl3N3O3 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 4-(4-chlorophenoxy)-1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)pentane-1,3-dione |
| SMILES | CC(Oc1ccc(Cl)cc1)C(=O)C(C(=O)c1ccc(Cl)cc1Cl)n1cncn1 |
| InChI | InChI=1S/C19H14Cl3N3O3/c1-11(28-14-5-2-12(20)3-6-14)18(26)17(25-10-23-9-24-25)19(27)15-7-4-13(21)8-16(15)22/h2-11,17H,1H3 |
| InChIKey | JXRMTBBGXMNURD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|