About 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid
3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid (PubChem CID 139595204) has the molecular formula C11H10ClN3O4
and a molecular weight of 283.67 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid |
| PubChem CID | 139595204 |
| Molecular Formula | C11H10ClN3O4 |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid |
| SMILES | O=C(O)C(O)C(Oc1ccc(Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C11H10ClN3O4/c12-7-1-3-8(4-2-7)19-10(9(16)11(17)18)15-6-13-5-14-15/h1-6,9-10,16H,(H,17,18) |
| InChIKey | HDKZYRRCVCEYKX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid?
The IUPAC name of 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid (CID 139595204) is 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid.
What is the SMILES notation for 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid?
The canonical SMILES for 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid is O=C(O)C(O)C(Oc1ccc(Cl)cc1)n1cncn1.
What is the InChIKey of 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid?
The InChIKey is HDKZYRRCVCEYKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN3O4/c12-7-1-3-8(4-2-7)19-10(9(16)11(17)18)15-6-13-5-14-15/h1-6,9-10,16H,(H,17,18).
What are the key properties of 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid?
3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid has a molecular weight of 283.67 g/mol, XLogP of 0.95, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenoxy)-2-hydroxy-3-(1,2,4-triazol-1-yl)propanoic acid is sourced from PubChem (CID 139595204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).