C22H32ClN3O5 — CID 70506956
4-[(4-chlorophenoxy)-(1,2,4-triazol-1-yl)methyl]-1-[2-(2-methoxyethoxy)ethoxy]-5,5-dimethylhexan-3-one (PubChem CID 70506956) has the molecular formula C22H32ClN3O5 and a molecular weight of 453.97 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)-(1,2,4-triazol-1-yl)methyl]-1-[2-(2-methoxyethoxy)ethoxy]-5,5-dimethylhexan-3-one.
| Compound Name | 4-[(4-chlorophenoxy)-(1,2,4-triazol-1-yl)methyl]-1-[2-(2-methoxyethoxy)ethoxy]-5,5-dimethylhexan-3-one |
|---|---|
| PubChem CID | 70506956 |
| Molecular Formula | C22H32ClN3O5 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 4-[(4-chlorophenoxy)-(1,2,4-triazol-1-yl)methyl]-1-[2-(2-methoxyethoxy)ethoxy]-5,5-dimethylhexan-3-one |
| SMILES | COCCOCCOCCC(=O)C(C(Oc1ccc(Cl)cc1)n1cncn1)C(C)(C)C |
| InChI | InChI=1S/C22H32ClN3O5/c1-22(2,3)20(19(27)9-10-29-13-14-30-12-11-28-4)21(26-16-24-15-25-26)31-18-7-5-17(23)6-8-18/h5-8,15-16,20-21H,9-14H2,1-4H3 |
| InChIKey | LXWPGWOIFYDGHB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|