C11H6Br3Cl2N3O2 — CID 56692672
[2,2,2-tribromo-1-(1,2,4-triazol-1-yl)ethyl] 2,4-dichlorobenzoate (PubChem CID 56692672) has the molecular formula C11H6Br3Cl2N3O2 and a molecular weight of 522.81 g/mol. Its IUPAC name is [2,2,2-tribromo-1-(1,2,4-triazol-1-yl)ethyl] 2,4-dichlorobenzoate.
| Compound Name | [2,2,2-tribromo-1-(1,2,4-triazol-1-yl)ethyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 56692672 |
| Molecular Formula | C11H6Br3Cl2N3O2 |
| Molecular Weight | 522.81 g/mol |
| Exact Mass | 518.74 |
| IUPAC Name | [2,2,2-tribromo-1-(1,2,4-triazol-1-yl)ethyl] 2,4-dichlorobenzoate |
| SMILES | O=C(OC(n1cncn1)C(Br)(Br)Br)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H6Br3Cl2N3O2/c12-11(13,14)10(19-5-17-4-18-19)21-9(20)7-2-1-6(15)3-8(7)16/h1-5,10H |
| InChIKey | WPBSCXNITIXYAW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.81 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|