C18H13Cl2N3O2 — CID 7218890
(Z)-1-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-2-(1,2,4-triazol-1-yl)prop-2-en-1-one (PubChem CID 7218890) has the molecular formula C18H13Cl2N3O2 and a molecular weight of 374.23 g/mol. Its IUPAC name is (Z)-1-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-2-(1,2,4-triazol-1-yl)prop-2-en-1-one.
| Compound Name | (Z)-1-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-2-(1,2,4-triazol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7218890 |
| Molecular Formula | C18H13Cl2N3O2 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | (Z)-1-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-2-(1,2,4-triazol-1-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C(/C(=O)c2ccc(Cl)cc2Cl)n2cncn2)cc1 |
| InChI | InChI=1S/C18H13Cl2N3O2/c1-25-14-5-2-12(3-6-14)8-17(23-11-21-10-22-23)18(24)15-7-4-13(19)9-16(15)20/h2-11H,1H3/b17-8- |
| InChIKey | JDSNHAKLXJLVQN-IUXPMGMMSA-N |
| XLogP | 4.47 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|