C20H18ClN3O — CID 70481580
1-(4-chlorophenyl)-4-methyl-4-phenyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one (PubChem CID 70481580) has the molecular formula C20H18ClN3O and a molecular weight of 351.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-methyl-4-phenyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one.
| Compound Name | 1-(4-chlorophenyl)-4-methyl-4-phenyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 70481580 |
| Molecular Formula | C20H18ClN3O |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 1-(4-chlorophenyl)-4-methyl-4-phenyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one |
| SMILES | CC(C)(C(=O)C(=Cc1ccc(Cl)cc1)n1cncn1)c1ccccc1 |
| InChI | InChI=1S/C20H18ClN3O/c1-20(2,16-6-4-3-5-7-16)19(25)18(24-14-22-13-23-24)12-15-8-10-17(21)11-9-15/h3-14H,1-2H3 |
| InChIKey | NUGHDQNWNSTDEW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|