C12H12ClN3O — CID 139595461
4-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one (PubChem CID 139595461) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one.
| Compound Name | 4-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one |
|---|---|
| PubChem CID | 139595461 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 4-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one |
| SMILES | O=C(CCc1ccc(Cl)cc1)Cn1cncn1 |
| InChI | InChI=1S/C12H12ClN3O/c13-11-4-1-10(2-5-11)3-6-12(17)7-16-9-14-8-15-16/h1-2,4-5,8-9H,3,6-7H2 |
| InChIKey | ISNFABYLLXYESP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |