About CID 11531699
CID 11531699 (PubChem CID 11531699) has the molecular formula C22H19FeN3O2+2
and a molecular weight of 413.26 g/mol.
Molecular Properties
| Compound Name | CID 11531699 |
| PubChem CID | 11531699 |
| Molecular Formula | C22H19FeN3O2+2 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | — |
| SMILES | COc1ccc(C(=O)/C(=C\[C]2[CH][CH][CH][CH]2)n2cncn2)cc1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C17H14N3O2.C5H5.Fe/c1-22-15-8-6-14(7-9-15)17(21)16(20-12-18-11-19-20)10-13-4-2-3-5-13;1-2-4-5-3-1;/h2-12H,1H3;1-5H;/q;;+2/b16-10+;; |
| InChIKey | DHGWRKLLTGHORD-CNSDMJOKSA-N |
| XLogP | 3.43 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 11531699 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11531699?
The IUPAC name of CID 11531699 (CID 11531699) is not available.
What is the SMILES notation for CID 11531699?
The canonical SMILES for CID 11531699 is COc1ccc(C(=O)/C(=C\[C]2[CH][CH][CH][CH]2)n2cncn2)cc1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 11531699?
The InChIKey is DHGWRKLLTGHORD-CNSDMJOKSA-N. The full InChI is InChI=1S/C17H14N3O2.C5H5.Fe/c1-22-15-8-6-14(7-9-15)17(21)16(20-12-18-11-19-20)10-13-4-2-3-5-13;1-2-4-5-3-1;/h2-12H,1H3;1-5H;/q;;+2/b16-10+;;.
What are the key properties of CID 11531699?
CID 11531699 has a molecular weight of 413.26 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11531699 is sourced from PubChem (CID 11531699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).