C21H20N4O2S — CID 6519053
(E)-3-anilino-1-(4-methoxyphenyl)-3-prop-2-enylsulfanyl-2-(1,2,4-triazol-1-yl)prop-2-en-1-one (PubChem CID 6519053) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is (E)-3-anilino-1-(4-methoxyphenyl)-3-prop-2-enylsulfanyl-2-(1,2,4-triazol-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-anilino-1-(4-methoxyphenyl)-3-prop-2-enylsulfanyl-2-(1,2,4-triazol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6519053 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (E)-3-anilino-1-(4-methoxyphenyl)-3-prop-2-enylsulfanyl-2-(1,2,4-triazol-1-yl)prop-2-en-1-one |
| SMILES | C=CCS/C(Nc1ccccc1)=C(\C(=O)c1ccc(OC)cc1)n1cncn1 |
| InChI | InChI=1S/C21H20N4O2S/c1-3-13-28-21(24-17-7-5-4-6-8-17)19(25-15-22-14-23-25)20(26)16-9-11-18(27-2)12-10-16/h3-12,14-15,24H,1,13H2,2H3/b21-19+ |
| InChIKey | CBLBPBBDDZGEET-XUTLUUPISA-N |
| XLogP | 4.33 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|