C18H16N2O2S — CID 4228084
(4-methoxyphenyl)-(2-prop-2-enylsulfanylbenzimidazol-1-yl)methanone (PubChem CID 4228084) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is (4-methoxyphenyl)-(2-prop-2-enylsulfanylbenzimidazol-1-yl)methanone.
| Compound Name | (4-methoxyphenyl)-(2-prop-2-enylsulfanylbenzimidazol-1-yl)methanone |
|---|---|
| PubChem CID | 4228084 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (4-methoxyphenyl)-(2-prop-2-enylsulfanylbenzimidazol-1-yl)methanone |
| SMILES | C=CCSc1nc2ccccc2n1C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H16N2O2S/c1-3-12-23-18-19-15-6-4-5-7-16(15)20(18)17(21)13-8-10-14(22-2)11-9-13/h3-11H,1,12H2,2H3 |
| InChIKey | TXTMDUDBLGPCIW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|