C49H46N2O7S — CID 132938450
(4-methoxyphenyl)-[2-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylbenzimidazol-1-yl]methanone (PubChem CID 132938450) has the molecular formula C49H46N2O7S and a molecular weight of 806.98 g/mol. Its IUPAC name is (4-methoxyphenyl)-[2-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylbenzimidazol-1-yl]methanone.
| Compound Name | (4-methoxyphenyl)-[2-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylbenzimidazol-1-yl]methanone |
|---|---|
| PubChem CID | 132938450 |
| Molecular Formula | C49H46N2O7S |
| Molecular Weight | 806.98 g/mol |
| Exact Mass | 806.30 |
| IUPAC Name | (4-methoxyphenyl)-[2-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylbenzimidazol-1-yl]methanone |
| SMILES | COc1ccc(C(=O)n2c(S[C@@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C49H46N2O7S/c1-53-40-28-26-39(27-29-40)47(52)51-42-25-15-14-24-41(42)50-49(51)59-48-46(57-33-38-22-12-5-13-23-38)45(56-32-37-20-10-4-11-21-37)44(55-31-36-18-8-3-9-19-36)43(58-48)34-54-30-35-16-6-2-7-17-35/h2-29,43-46,48H,30-34H2,1H3/t43-,44-,45+,46-,48+/m1/s1 |
| InChIKey | OKAKQAAWPYHUHV-IXAZANRKSA-N |
| XLogP | 9.52 |
| TPSA | 90.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.98 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |