C17H16N2O2S2 — CID 4642224
1-(4-methylphenyl)sulfonyl-2-prop-2-enylsulfanylbenzimidazole (PubChem CID 4642224) has the molecular formula C17H16N2O2S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-prop-2-enylsulfanylbenzimidazole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-prop-2-enylsulfanylbenzimidazole |
|---|---|
| PubChem CID | 4642224 |
| Molecular Formula | C17H16N2O2S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-prop-2-enylsulfanylbenzimidazole |
| SMILES | C=CCSc1nc2ccccc2n1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H16N2O2S2/c1-3-12-22-17-18-15-6-4-5-7-16(15)19(17)23(20,21)14-10-8-13(2)9-11-14/h3-11H,1,12H2,2H3 |
| InChIKey | JBNJMOHTEBRTJV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|