C28H22N2O2S — CID 122223410
2-(2,2-diphenylethenyl)-1-(4-methylphenyl)sulfonylbenzimidazole (PubChem CID 122223410) has the molecular formula C28H22N2O2S and a molecular weight of 450.56 g/mol. Its IUPAC name is 2-(2,2-diphenylethenyl)-1-(4-methylphenyl)sulfonylbenzimidazole.
| Compound Name | 2-(2,2-diphenylethenyl)-1-(4-methylphenyl)sulfonylbenzimidazole |
|---|---|
| PubChem CID | 122223410 |
| Molecular Formula | C28H22N2O2S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-(2,2-diphenylethenyl)-1-(4-methylphenyl)sulfonylbenzimidazole |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C=C(c3ccccc3)c3ccccc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C28H22N2O2S/c1-21-16-18-24(19-17-21)33(31,32)30-27-15-9-8-14-26(27)29-28(30)20-25(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-20H,1H3 |
| InChIKey | OQNHCVDSXAVFCQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |